Chondramide B | CAS No. | 172430-61-4 |
| Molecular Weight | 683.23 |
| Formula | C36H47ClN4O7 |
| SMILES | O=C([C@@H](OC)[C@H](C1=CC=C(O)C=C1)NC([C@@H](CC2C3=C(C=CC=C3)NC2Cl)N(C([C@H](C)N4)=O)C)=O)O[C@H](C)[C@H](C)/C=C(C)\C[C@H](C)C4=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-24077 | Ostreogrycin B3 | Inquiry |
|
| MDP-23588 | Collismycin B | Inquiry |
|
| MDP-22798 | Tigecycline (Standard) | Inquiry |
|
| MDP-22566 | Linoleamide (Standard) | Inquiry |
|
| MDP-12509 | Aranorosin | Inquiry |
|
| MDP-24260 | Cerexin A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.