Chrysoeriol | Appearance | Solid |
| CAS | 491-71-4 |
| Purity | 99.97% |
| Molecular Weight | 300.26 |
| Formula | C16H12O6 |
| Color | Light yellow to yellow |
| SMILES | O=C1C=C(C2=CC=C(O)C(OC)=C2)OC3=CC(O)=CC(O)=C13 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-16340 | 3,3'-Di-O-methylellagic Acid-4'-O-β-D-glucopyranoside | Inquiry |
|
| PDP-16282 | Aureusidin | Inquiry |
|
| PDP-13724 | Ellipticine Hydrochloride | Inquiry |
|
| PDP-18177 | Mesuaxanthone A | Inquiry |
|
| PDP-18353 | Epimedokoreanin B | Inquiry |
|
| PDP-19534 | Lunarine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.