Clavicoronic Acid | CAS No. | 139748-98-4 |
| Molecular Weight | 262.30 |
| Formula | C15H18O4 |
| SMILES | CC1=C(C(C(O)=O)=O)C(C=O)=C[C@@]2([H])[C@]1([H])CC(C)(C)C2 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23450 | Ashimycin B | Inquiry |
|
| MDP-23720 | Dactylocycline E | Inquiry |
|
| MDP-11448 | Linalool | Inquiry |
|
| MDP-10921 | Puromycin Dihydrochloride | Inquiry |
|
| MDP-22648 | 5-Methyl-2-thiophenecarboxaldehyde (Standard) | Inquiry |
|
| MDP-24262 | Glidobactin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
