Demethoxycentaureidin | Synonyms | NSC 689466 |
| CAS | 22934-99-2 |
| Molecular Weight | 330.29 |
| Formula | C17H14O7 |
| SMILES | O=C1C=C(C2=CC=C(OC)C(O)=C2)OC3=CC(O)=C(OC)C(O)=C13 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-14983 | Steppogenin | Inquiry |
|
| PDP-17643 | Batatasin V | Inquiry |
|
| PDP-15092 | (Rac)-Hesperetin | Inquiry |
|
| PDP-17075 | Sonnerphenolic B | Inquiry |
|
| PDP-19400 | (+)-Piperitol-3,3-dimethylallyl Ether | Inquiry |
|
| PDP-19970 | Darutoside (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
