Dimethyl Lithospermate B | Synonyms | dmLSB |
| Appearance | Solid |
| CAS | 875313-64-7 |
| Purity | 98.85% |
| Molecular Weight | 746.67 |
| Formula | C38H34O16 |
| Color | White to off-white |
| SMILES | OC1=C(O)C=CC(C[C@H](C(OC)=O)OC([C@H]2C3=C(/C=C/C(O[C@@H](C(OC)=O)CC4=CC(O)=C(O)C=C4)=O)C=CC(O)=C3O[C@@H]2C5=CC(O)=C(O)C=C5)=O)=C1 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17100 | Garcinone B | Inquiry |
|
| PDP-19887 | Macranthoidin A (Standard) | Inquiry |
|
| PDP-15247 | 5,7-Dimethoxyflavanone | Inquiry |
|
| PDP-18304 | Cycloheterophyllin | Inquiry |
|
| PDP-14745 | Isoeleutherin | Inquiry |
|
| PDP-18044 | 6-O-Syringoylajugol | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
