Endophenazine B | CAS No. | 479415-40-2 |
| Molecular Weight | 322.36 |
| Formula | C19H18N2O3 |
| SMILES | O=C1C=C2N(C3=CC=CC(C(O)=O)=C3N=C2C(C/C=C(C)\C)=C1)C |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-11987 | Veratryl Alcohol | Inquiry |
|
| MDP-23804 | Cytochalasin G | Inquiry |
|
| MDP-12303 | 6-Hydroxywogonin | Inquiry |
|
| MDP-22432 | Menadiol (Standard) | Inquiry |
|
| MDP-24106 | 1-Deamino-1-hydroxygentamicin C2 | Inquiry |
|
| MDP-11506 | Delphinidin 3-glucoside Chloride | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
