Englerin A (Standard) | CAS | 1094250-15-3 |
| Molecular Weight | 442.54 |
| Formula | C26H34O6 |
| SMILES | O=C(O[C@@H]1[C@]2(C(C)C)C[C@@H](OC(CO)=O)[C@](O2)(C)[C@]3([H])CC[C@@H](C)[C@@]13[H])/C=C/C4=CC=CC=C4 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13951 | Ponicidin | Inquiry |
|
| PDP-17808 | Cyanidin 3-sophoroside-5-glucoside | Inquiry |
|
| PDP-20097 | Prehelminthosporolactone | Inquiry |
|
| PDP-19048 | 9-Hydroxyeriobofuran | Inquiry |
|
| PDP-17463 | 8-Methoxymarmesin | Inquiry |
|
| PDP-18872 | Nepetoidin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
