Epoxyquinomicin A | CAS No. | 175448-31-4 |
| Molecular Weight | 323.69 |
| Formula | C14H10ClNO6 |
| SMILES | OC[C@]12[C@](C(C(NC(C3=C(C(Cl)=CC=C3)O)=O)=CC2=O)=O)([H])O1 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23558 | Cystothiazole B | Inquiry |
|
| MDP-22971 | Kinamycin B | Inquiry |
|
| MDP-24239 | Cephaibol D | Inquiry |
|
| MDP-23321 | Azlocillin (Standard) | Inquiry |
|
| MDP-23235 | 2-Furoic Acid (Standard) | Inquiry |
|
| MDP-11139 | Lipoic Acid | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
