Ginsenoside Rd | Synonyms | Gypenoside VIII |
| Appearance | Solid |
| CAS | 52705-93-8 |
| Purity | 99.88% |
| Molecular Weight | 947.15 |
| Formula | C48H82O18 |
| Color | White to off-white |
| SMILES | C[C@](CC/C=C(C)/C)([C@]1([H])[C@]([C@H](O)C[C@@]2([H])[C@@]3(C)CC[C@]4([H])[C@]2(C)CC[C@H](O[C@]5([H])O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O[C@]6([H])O[C@H](CO)[C@@H](O)[C@H](O)[C@H]6O)C4(C)C)([H])[C@@]3(C)CC1)O[C@@H]7O[C@H](CO)[C@@H](O)[C@H](O)[C@H]7O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 2 years; -20°C 1 year |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15628 | Ginsenoside Rg4 | Inquiry |
|
| PDP-17609 | threo-Guaiacylglycerol Beta-coniferyl Ether | Inquiry |
|
| PDP-14650 | Pulchinenoside A | Inquiry |
|
| PDP-19330 | Methylswertianin | Inquiry |
|
| PDP-19176 | Dehydrojuncuenin B | Inquiry |
|
| PDP-17231 | Geissoschizoline | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
