Haemanthamine Hydrochloride | Molecular Weight | 337.80 |
| Formula | C17H20ClNO4 |
| SMILES | O[C@@H](C1)[C@@]2(C=C3)C4=CC(OCO5)=C5C=C4C[N@@]1[C@@]2([H])C[C@@H]3OC.[H]Cl |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-13262 | Berbamine | Inquiry |
|
| PDP-17100 | Garcinone B | Inquiry |
|
| PDP-14258 | Chrysene | Inquiry |
|
| PDP-15656 | 11-Deoxymogroside V | Inquiry |
|
| PDP-15790 | Kaempferol-7,4'-dimethyl Ether | Inquiry |
|
| PDP-16299 | Perlolyrin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
