Perlolyrin | Synonyms | Tribulusterine |
| CAS | 29700-20-7 |
| Molecular Weight | 264.28 |
| Formula | C16H12N2O2 |
| SMILES | OCC1=CC=C(O1)C2=NC=CC3=C2NC4=C3C=CC=C4 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17873 | Myrrhterpenoid O | Inquiry |
|
| PDP-18582 | Lycoramine | Inquiry |
|
| PDP-19683 | Monocrotaline N-Oxide (Standard) | Inquiry |
|
| PDP-13765 | Ginsenoside Rg2 | Inquiry |
|
| PDP-18280 | Cleroindicin B | Inquiry |
|
| PDP-14051 | (+)-Magnoflorine Chloride | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
