Licoricesaponin E2 | CAS | 119417-96-8 |
| Molecular Weight | 820.92 |
| Formula | C42H60O16 |
| SMILES | C[C@]12CC[C@H](O[C@H]3[C@H](O[C@H]4[C@H](O)[C@@H](O)[C@H](O)[C@@H](C(O)=O)O4)[C@@H](O)[C@H](O)[C@@H](C(O)=O)O3)C(C)(C)[C@@H]1CC[C@]5(C)[C@@H]2C(C=C6[C@@]5(C)CC[C@]7(C)[C@H]6C[C@]8(C)C[C@H]7OC8=O)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-19015 | Glucolimnanthin | Inquiry |
|
| PDP-20239 | Perilla Ketone | Inquiry |
|
| PDP-16614 | Cannabinodiol | Inquiry |
|
| PDP-18134 | N-trans-Feruloyl-3-methyldopamine | Inquiry |
|
| PDP-20516 | Calycosin (Standard) | Inquiry |
|
| PDP-16600 | Panaxcerol B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
