Mureidomycin A | CAS No. | 114797-04-5 |
| Molecular Weight | 840.90 |
| Formula | C38H48N8O12S |
| SMILES | O=C1C=CN(C2O/C(CC2O)=C/NC(C(C(C)N(C)C(C(CC3=CC(O)=CC=C3)N)=O)NC(C(CCSC)NC(NC(CC4=CC(O)=CC=C4)C(O)=O)=O)=O)=O)C(N1)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23787 | Marcellomycin | Inquiry |
|
| MDP-23476 | Arisugacin B | Inquiry |
|
| MDP-22518 | Acremorin E | Inquiry |
|
| MDP-23606 | Epopromycin B | Inquiry |
|
| MDP-11837 | alpha-D-glucose | Inquiry |
|
| MDP-22990 | Cyclamidomycin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
