N-Feruloylserotonin | Synonyms | (E/Z)-Moschamine |
| Appearance | Solid |
| CAS | 68573-23-9 |
| Purity | 99.93% |
| Molecular Weight | 352.38 |
| Formula | C20H20N2O4 |
| Color | White to off-white |
| SMILES | O=C(/C=C/C1=CC=C(C(OC)=C1)O)NCCC2=CNC3=C2C=C(C=C3)O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18389 | Gardneramine | Inquiry |
|
| PDP-14481 | Agnuside | Inquiry |
|
| PDP-16385 | Afzelin (Standard) | Inquiry |
|
| PDP-18947 | Heteroclitin B | Inquiry |
|
| PDP-13580 | Peiminine | Inquiry |
|
| PDP-15085 | Hamamelitannin | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
