O-Methylsterigmatocystin | CAS No. | 17878-69-2 |
| Purity | 99.3% |
| Molecular Weight | 338.31 |
| Formula | C19H14O6 |
| Appearance | Solid |
| Color | White to off-white |
| SMILES | O=C1C2=C(OC3=C1C(OC)=CC4=C3[C@]5([H])C=CO[C@@]5(O4)[H])C=CC=C2OC |
| Intended Use | For research use only. |
| Shipping | Room temperature |
| Storage |
Powder: -20°C 3 years In solvent: -80°C 6 months; -20°C 1 month |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22529 | Chaetochromin A | Inquiry |
|
| MDP-23910 | Cinnatriacetin B | Inquiry |
|
| MDP-21928 | Lucidenic Acid F | Inquiry |
|
| MDP-22879 | TDD | Inquiry |
|
| MDP-12622 | Sterpurol D | Inquiry |
|
| MDP-23912 | Cinatrin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
