Paeciloquinone C | CAS No. | 92439-42-4 |
| Molecular Weight | 302.24 |
| Formula | C15H10O7 |
| SMILES | O=C1C2=C(C(C3=C(C(CO)=C(C=C13)O)O)=O)C(O)=CC(O)=C2 |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23111 | Lynamicin B | Inquiry |
|
| MDP-22997 | Nannochelin A | Inquiry |
|
| MDP-23160 | Cyclo(Tyr-Gly) | Inquiry |
|
| MDP-21920 | Stachartin B | Inquiry |
|
| MDP-24096 | 5-Hydroxymethyltubercidin | Inquiry |
|
| MDP-24022 | Paeciloquinone D | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
