Phenochalasin B | CAS No. | 207679-46-7 |
| Molecular Weight | 525.59 |
| Formula | C29H35NO8 |
| SMILES | O=C(/C=C/C[C@]1(O)C)/C=C2[C@]3(OCO[C@@H](C)C1=O)[C@H](C)N(C)[C@@H](CC4=CC=C(OC)C=C4)C3CC5=C/2O5=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-24040 | Gunacin | Inquiry |
|
| MDP-21996 | Versipelostatin | Inquiry |
|
| MDP-22783 | 4-Acetamidobutanoic Acid (Standard) | Inquiry |
|
| MDP-22983 | Capoamycin | Inquiry |
|
| MDP-22592 | 3-epi-Resibufogenin | Inquiry |
|
| MDP-24003 | Glucopiericidin B | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
