(+)-Intermedine (Standard) | CAS | 10285-06-0 |
| Molecular Weight | 299.36 |
| Formula | C15H25NO5 |
| SMILES | CC(C)[C@@]([C@H](O)C)(O)C(OCC1=CCN2[C@@]1([H])[C@H](O)CC2)=O |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17488 | 7-O-methylepimedonin G | Inquiry |
|
| PDP-18290 | Coronarin B | Inquiry |
|
| PDP-17183 | Hyperectumine | Inquiry |
|
| PDP-17625 | Inflexuside A | Inquiry |
|
| PDP-14350 | Lignin | Inquiry |
|
| PDP-16158 | Polygalaxanthone XI | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
