Rebaudioside A | Appearance | Solid |
| CAS | 58543-16-1 |
| Purity | ≥98.0% |
| Molecular Weight | 967.01 |
| Formula | C44H70O23 |
| Color | White to off-white |
| SMILES | C[C@]12[C@@]3([H])[C@@](C4)(CC[C@]1([H])[C@@](C)(CCC2)C(O[C@@H]5O[C@@H]([C@@H](O)[C@H](O)[C@H]5O)CO)=O)C[C@@](C4=C)(O[C@@]6([H])[C@@H]([C@H]([C@H](O)[C@@H](CO)O6)O[C@]7([H])O[C@@H]([C@@H](O)[C@H](O)[C@H]7O)CO)O[C@]8([H])O[C@@H]([C@@H](O)[C@H](O)[C@H]8O)CO)CC3 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
Powder: -20°C 3 years; 4°C 2 years In solvent: -80°C 2 years; -20°C 1 year |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-18872 | Nepetoidin B | Inquiry |
|
| PDP-14444 | Capillarisin | Inquiry |
|
| PDP-20064 | Isonaringin (Standard) | Inquiry |
|
| PDP-15614 | Macranthoside B | Inquiry |
|
| PDP-15593 | Gelsevirine | Inquiry |
|
| PDP-14401 | Shanzhiside Methyl Ester | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
