Salfredin A4 | CAS No. | 139542-54-4 |
| Molecular Weight | 321.28 |
| Formula | C15H15NO7 |
| SMILES | O=C1C2=CC(O[C@@](C3)([H])[C@H](C)C(O)=O)=C3C(O)=C2CN1CC(O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-12080 | Spermine (Standard) | Inquiry |
|
| MDP-23822 | Izumenolide | Inquiry |
|
| MDP-11615 | Ikarugamycin | Inquiry |
|
| MDP-12743 | Mollicellin H | Inquiry |
|
| MDP-23010 | Dihydrotrichotetronine | Inquiry |
|
| MDP-21889 | Xanthoquinodin A1 | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
