Sporogen AO-1 | CAS No. | 88418-12-6 |
| Molecular Weight | 248.32 |
| Formula | C15H20O3 |
| SMILES | CC([C@]1(C(C=C2CC[C@H]3O)=O)[C@]([C@@]2([C@H]3C)C)([H])O1)=C |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-23689 | Fostriecin | Inquiry |
|
| MDP-12647 | (+)-Sorokinianin | Inquiry |
|
| MDP-11658 | Streptolysin O | Inquiry |
|
| MDP-24165 | Pelagiomicin C | Inquiry |
|
| MDP-23148 | Remisporine B | Inquiry |
|
| MDP-23720 | Dactylocycline E | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
