Steviolbioside | Appearance | Solid |
| CAS | 41093-60-1 |
| Purity | 99.58% |
| Molecular Weight | 642.73 |
| Formula | C32H50O13 |
| Color | White to off-white |
| SMILES | C[C@]12[C@@]3([H])[C@@](C4)(CC[C@]1([H])[C@@](C)(CCC2)C(O)=O)C[C@@](C4=C)(O[C@@]5([H])[C@@H]([C@H]([C@H](O)[C@@H](CO)O5)O)O[C@]6([H])O[C@@H]([C@@H](O)[C@H](O)[C@H]6O)CO)CC3 |
| Intended Use | For research and further manufacturing use only. |
| Storage |
4°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17412 | Bruceine C | Inquiry |
|
| PDP-18976 | Neophellamuretin | Inquiry |
|
| PDP-16514 | Corytuberine | Inquiry |
|
| PDP-20173 | 10-Deacetyltaxol (Standard) | Inquiry |
|
| PDP-14512 | Loureirin B | Inquiry |
|
| PDP-14963 | Calcium Phytate | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
