2-8ºC, shun light, argon filled.
Xylotetraose 
Catalog Number OM-5696
Product Name Xylotetraose
CAS No. 22416-58-6
Size 10 mg; 25 mg;
Aspect White solid
| CAS No. | 22416-58-6 |
| Molecular Formula | C20H34O17 |
| MW | 546.474 |
| Melting Point | 219-220ºC(lit.) |
| Boiling Point | 907.1±65.0ºC(lit.) |
| Application | Can be used for enzyme biochemical analysis. |
| Solubility | Slightly soluble. |
| Synonyms | Xylopyranose |
| MDL | MFCD28064298 |
| SMILES | C1C(C(C(C(O1)OC2COC(C(C2O)O)OC3COC(C(C3O)O)OC(CO)C(C(C=O)O)O)O)O)O |
| InchiKey | JVZHSOSUTPAVII-UHFFFAOYSA-N |
2-8ºC, shun light, argon filled.
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| OM-5639 | 6-Azido-6-Deoxy-D-Galactopyranose | Inquiry |
|
| OM-5758 | Dextrose | Inquiry |
|
| OM-5689 | D-(+)-Turanose | Inquiry |
|
| OM-5489 | 3-O-Acetyl-1,2:5,6-Di-O-Isopropylidene-α-D-Galactofuranose | Inquiry |
|
| OM-5339 | Alpha-D-Fructopyranose | Inquiry |
|
| OM-5796 | Dithioerythritol(Dte) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
