Zederone | Appearance | Solid |
| CAS | 7727-79-9 |
| Purity | 99.61% |
| Molecular Weight | 246.30 |
| Formula | C15H18O3 |
| Color | White to yellow |
| SMILES | CC1=COC(C/C(C)=C/CC[C@]2(C)[C@@]3([H])O2)=C1C3=O |
| Intended Use | For research and further manufacturing use only. |
| Storage |
-20°C, protect from light In solvent: -80°C, 6 months; -20°C, 1 month (protect from light) |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17092 | (R)-IDHP | Inquiry |
|
| PDP-18947 | Heteroclitin B | Inquiry |
|
| PDP-13438 | Esculin | Inquiry |
|
| PDP-17449 | Abiesadine F | Inquiry |
|
| PDP-17585 | Regaloside K | Inquiry |
|
| PDP-19125 | Macarangioside D | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
