Cernuumolide J | Synonyms | TMJ-105 |
| CAS | 2019163-02-9 |
| Molecular Weight | 450.52 |
| Formula | C24H34O8 |
| SMILES | CC(C)C(O[C@@H]1[C@]2([H])[C@@](C(C(O2)=O)=C)([H])[C@@H](C([C@@H](CCC[C@@]1(O)C)C)=O)OC(/C(C)=C\C)=O)=O |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15119 | Methyl Isoeugenol | Inquiry |
|
| PDP-17077 | Volvaltrate B | Inquiry |
|
| PDP-14681 | Neoglycyrol | Inquiry |
|
| PDP-18238 | Isotaxiresinol | Inquiry |
|
| PDP-18590 | Triglochinic Acid | Inquiry |
|
| PDP-17213 | Dihydrochelirubine | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
