Rhynchophylline (Standard) | CAS | 76-66-4 |
| Molecular Weight | 384.47 |
| Formula | C22H28N2O4 |
| SMILES | O=C(NC1=C2C=CC=C1)[C@]32[C@@](C[C@H](/C(C(OC)=O)=C\OC)[C@@H](CC)C4)([H])N4CC3 |
| Intended Use | For research and further manufacturing use only. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-15101 | Rhein 8-Glucoside | Inquiry |
|
| PDP-13792 | Liriopesides B | Inquiry |
|
| PDP-18132 | N-Methylflindersine | Inquiry |
|
| PDP-15808 | Ursolic Acid (Standard) | Inquiry |
|
| PDP-14919 | Notoginsenoside Fe | Inquiry |
|
| PDP-14974 | Hederacoside D | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
