TS 155-2 | CAS No. | 1314486-37-7 |
| Synonyms | JBIR 100 |
| Molecular Weight | 704.89 |
| Formula | C39H60O11 |
| SMILES | O=C(O[C@@H]1C[C@@]([C@@H](C)[C@H](O)[C@@H]([C@H]([C@@H](OC)/C=C/C=C(C)/C[C@H](C)[C@H](O)[C@H](C)/C=C(C)/C=C2\C)OC2=O)C)(O)O[C@H](C(C)C)[C@H]1C)/C=C/C(O)=O |
| Intended Use | For research use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| MDP-22983 | Capoamycin | Inquiry |
|
| MDP-11531 | Sinapyl Alcohol | Inquiry |
|
| MDP-24058 | Mureidomycin B | Inquiry |
|
| MDP-22249 | (S)-17-Hydroxy-18,20-ene-neogrifolin | Inquiry |
|
| MDP-11310 | Ubiquinone-1 | Inquiry |
|
| MDP-12346 | Shikimic Acid (Standard) | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
