Vasicinolone | CAS | 84847-50-7 |
| Molecular Weight | 218.21 |
| Formula | C11H10N2O3 |
| SMILES | O=C1N2C([C@@H](O)CC2)=NC3=C1C=C(O)C=C3 |
| Intended Use | For research and further manufacturing use only. |
| Shipping | Room temperature. |
| Catalog Number | Product Name | Order | Quantity |
|---|---|---|---|
| PDP-17215 | Shinjulactone M | Inquiry |
|
| PDP-15687 | Licoflavone B | Inquiry |
|
| PDP-13270 | β-Elemene | Inquiry |
|
| PDP-14246 | Kahweol | Inquiry |
|
| PDP-15408 | Neotheaflavin | Inquiry |
|
| PDP-15557 | Taccalonolide A | Inquiry |
|
CD BioSustainable is a well-known professional company in the industry. We provide a wide range of bio-environmental products, including bio-based materials, biomass fuels, green building materials, bio-environmental enzymes, bio-environmental microorganisms, etc. Please feel free to explore.
Our products and services are for research use only and cannot be used for any clinical purposes.
